C42H26N6O — CID 159917708
4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(4-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 159917708) has the molecular formula C42H26N6O and a molecular weight of 630.71 g/mol. Its IUPAC name is 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(4-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(4-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 159917708 |
| Molecular Formula | C42H26N6O |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(4-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)nc4c3oc3ncccc34)cc2)cc1 |
| InChI | InChI=1S/C42H26N6O/c1-4-11-27(12-5-1)28-18-20-29(21-19-28)35-37-36(34-17-10-26-43-42(34)49-37)45-38(44-35)32-22-24-33(25-23-32)41-47-39(30-13-6-2-7-14-30)46-40(48-41)31-15-8-3-9-16-31/h1-26H |
| InChIKey | NXZPMUIXDKYZPQ-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |