C49H31N5O — CID 162775027
6-(4-phenylphenyl)-4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 162775027) has the molecular formula C49H31N5O and a molecular weight of 705.82 g/mol. Its IUPAC name is 6-(4-phenylphenyl)-4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-(4-phenylphenyl)-4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 162775027 |
| Molecular Formula | C49H31N5O |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | 6-(4-phenylphenyl)-4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5nc(-c6ccc(-c7ccccc7)cc6)c6oc7ncccc7c6n5)cc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C49H31N5O/c1-4-11-32(12-5-1)34-18-22-36(23-19-34)42-31-43(52-47(51-42)39-15-8-3-9-16-39)37-24-28-40(29-25-37)48-53-44(46-45(54-48)41-17-10-30-50-49(41)55-46)38-26-20-35(21-27-38)33-13-6-2-7-14-33/h1-31H |
| InChIKey | OBBCFKAVZNGTBI-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |