C76H109GaN17O22 — CID 159918128
CID 159918128 (PubChem CID 159918128) has the molecular formula C76H109GaN17O22 and a molecular weight of 1680.73 g/mol.
| Compound Name | CID 159918128 |
|---|---|
| PubChem CID | 159918128 |
| Molecular Formula | C76H109GaN17O22 |
| Molecular Weight | 1680.73 g/mol |
| Exact Mass | 1679.72 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(CO)NC(=O)C(Cc1ccccc1)NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](CC(=O)O)NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CO)C(=O)O.[68Ga] |
| InChI | InChI=1S/C76H109N17O22.Ga/c1-45(2)32-54(68(107)87-58(72(111)89-61(44-95)75(114)115)36-49-38-80-52-17-10-9-16-51(49)52)83-69(108)57(35-48-19-21-50(96)22-20-48)84-67(106)53(18-11-23-79-76(77)78)82-74(113)60(43-94)88-71(110)56(34-47-14-7-4-8-15-47)85-70(109)55(33-46-12-5-3-6-13-46)86-73(112)59(37-63(98)99)81-62(97)39-90-24-26-91(40-64(100)101)28-30-93(42-66(104)105)31-29-92(27-25-90)41-65(102)103;/h4,7-10,14-17,19-22,38,45-46,53-61,80,94-96H,3,5-6,11-13,18,23-37,39-44H2,1-2H3,(H,81,97)(H,82,113)(H,83,108)(H,84,106)(H,85,109)(H,86,112)(H,87,107)(H,88,110)(H,89,111)(H,98,99)(H,100,101)(H,102,103)(H,104,105)(H,114,115)(H4,77,78,79);/t53?,54-,55-,56?,57-,58-,59+,60?,61-;/m0./s1/i;1-2 |
| InChIKey | FDGRJMGUMCLYFB-SCSXMFASSA-N |
| XLogP | -4.03 |
| TPSA | 602.24 Ų |
| H-Bond Donors | 20 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 116 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1680.73 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 20 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|