C23H20N2O3S — CID 15991979
2-(4-benzylpiperazine-1-carbonyl)thieno[3,2-c]chromen-4-one (PubChem CID 15991979) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1-carbonyl)thieno[3,2-c]chromen-4-one.
| Compound Name | 2-(4-benzylpiperazine-1-carbonyl)thieno[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 15991979 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(4-benzylpiperazine-1-carbonyl)thieno[3,2-c]chromen-4-one |
| SMILES | O=C(c1cc2c(=O)oc3ccccc3c2s1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H20N2O3S/c26-22(25-12-10-24(11-13-25)15-16-6-2-1-3-7-16)20-14-18-21(29-20)17-8-4-5-9-19(17)28-23(18)27/h1-9,14H,10-13,15H2 |
| InChIKey | WZQPSMCKOXINIU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|