C29H37NO2 — CID 159926566
4-(benzhydryloxymethyl)-1-[2-(4-methoxyphenyl)ethyl]piperidine;tritiomethane (PubChem CID 159926566) has the molecular formula C29H37NO2 and a molecular weight of 433.63 g/mol. Its IUPAC name is 4-(benzhydryloxymethyl)-1-[2-(4-methoxyphenyl)ethyl]piperidine;tritiomethane.
| Compound Name | 4-(benzhydryloxymethyl)-1-[2-(4-methoxyphenyl)ethyl]piperidine;tritiomethane |
|---|---|
| PubChem CID | 159926566 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 4-(benzhydryloxymethyl)-1-[2-(4-methoxyphenyl)ethyl]piperidine;tritiomethane |
| SMILES | COc1ccc(CCN2CCC(COC(c3ccccc3)c3ccccc3)CC2)cc1.[3H]C |
| InChI | InChI=1S/C28H33NO2.CH4/c1-30-27-14-12-23(13-15-27)16-19-29-20-17-24(18-21-29)22-31-28(25-8-4-2-5-9-25)26-10-6-3-7-11-26;/h2-15,24,28H,16-22H2,1H3;1H4/i;1T |
| InChIKey | NZBWJNSIYWXBSN-WMTCLNHOSA-N |
| XLogP | 6.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |