About 1-tert-butyl-3-methylpyrazole;deuterium monohydride
1-tert-butyl-3-methylpyrazole;deuterium monohydride (PubChem CID 159926640) has the molecular formula C8H16N2
and a molecular weight of 141.24 g/mol. Its IUPAC name is 1-tert-butyl-3-methylpyrazole;deuterium monohydride.
Molecular Properties
| Compound Name | 1-tert-butyl-3-methylpyrazole;deuterium monohydride |
| PubChem CID | 159926640 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.14 |
| IUPAC Name | 1-tert-butyl-3-methylpyrazole;deuterium monohydride |
| SMILES | Cc1ccn(C(C)(C)C)n1.[H][2H] |
| InChI | InChI=1S/C8H14N2.H2/c1-7-5-6-10(9-7)8(2,3)4;/h5-6H,1-4H3;1H/i;1+1 |
| InChIKey | NZCDHKIWFHKXJH-IEOVAKBOSA-N |
| XLogP | 2.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3-methylpyrazole;deuterium monohydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-methylpyrazole;deuterium monohydride?
The IUPAC name of 1-tert-butyl-3-methylpyrazole;deuterium monohydride (CID 159926640) is 1-tert-butyl-3-methylpyrazole;deuterium monohydride.
What is the SMILES notation for 1-tert-butyl-3-methylpyrazole;deuterium monohydride?
The canonical SMILES for 1-tert-butyl-3-methylpyrazole;deuterium monohydride is Cc1ccn(C(C)(C)C)n1.[H][2H].
What is the InChIKey of 1-tert-butyl-3-methylpyrazole;deuterium monohydride?
The InChIKey is NZCDHKIWFHKXJH-IEOVAKBOSA-N. The full InChI is InChI=1S/C8H14N2.H2/c1-7-5-6-10(9-7)8(2,3)4;/h5-6H,1-4H3;1H/i;1+1.
What are the key properties of 1-tert-butyl-3-methylpyrazole;deuterium monohydride?
1-tert-butyl-3-methylpyrazole;deuterium monohydride has a molecular weight of 141.24 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-methylpyrazole;deuterium monohydride is sourced from PubChem (CID 159926640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).