C21H20F2O4S2 — CID 159926706
1,1-difluoro-2-hydroxyethanesulfonate;(4-methylphenyl)-diphenylsulfanium (PubChem CID 159926706) has the molecular formula C21H20F2O4S2 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxyethanesulfonate;(4-methylphenyl)-diphenylsulfanium.
| Compound Name | 1,1-difluoro-2-hydroxyethanesulfonate;(4-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 159926706 |
| Molecular Formula | C21H20F2O4S2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1,1-difluoro-2-hydroxyethanesulfonate;(4-methylphenyl)-diphenylsulfanium |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)CO |
| InChI | InChI=1S/C19H17S.C2H4F2O4S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;3-2(4,1-5)9(6,7)8/h2-15H,1H3;5H,1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | NZCLHDVUYUEEQY-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|