C15H13N3O — CID 159927533
9-methyl-3,9,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,12,14,16-hexaen-8-one (PubChem CID 159927533) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 9-methyl-3,9,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,12,14,16-hexaen-8-one.
| Compound Name | 9-methyl-3,9,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,12,14,16-hexaen-8-one |
|---|---|
| PubChem CID | 159927533 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 9-methyl-3,9,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,12,14,16-hexaen-8-one |
| SMILES | CN1C(=O)C2C=CC=NC2=C2C=C3C=CC=CC3N21 |
| InChI | InChI=1S/C15H13N3O/c1-17-15(19)11-6-4-8-16-14(11)13-9-10-5-2-3-7-12(10)18(13)17/h2-9,11-12H,1H3 |
| InChIKey | HUUVEQXYHSPISW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |