C16H22N2O4 — CID 15992925
3-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 15992925) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 15992925 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCN1C(=O)C(C)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C16H22N2O4/c1-11-4-5-14-13(10-11)18(16(20)12(2)22-14)8-6-15(19)17-7-9-21-3/h4-5,10,12H,6-9H2,1-3H3,(H,17,19) |
| InChIKey | CRWOYIDFAZIFLN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|