C25H17F3N8O3S — CID 159929433
3-(methylamino)-4-nitrobenzonitrile;3-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbonitrile (PubChem CID 159929433) has the molecular formula C25H17F3N8O3S and a molecular weight of 566.53 g/mol. Its IUPAC name is 3-(methylamino)-4-nitrobenzonitrile;3-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbonitrile.
| Compound Name | 3-(methylamino)-4-nitrobenzonitrile;3-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 159929433 |
| Molecular Formula | C25H17F3N8O3S |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 3-(methylamino)-4-nitrobenzonitrile;3-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbonitrile |
| SMILES | CNc1cc(C#N)ccc1[N+](=O)[O-].Cn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C17H10F3N5OS.C8H7N3O2/c1-25-13-6-9(8-21)2-4-11(13)22-15(25)24-16-23-12-5-3-10(7-14(12)27-16)26-17(18,19)20;1-10-7-4-6(5-9)2-3-8(7)11(12)13/h2-7H,1H3,(H,22,23,24);2-4,10H,1H3 |
| InChIKey | NZLHIMYPFZNRDE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|