C11H12N2OS — CID 159931242
1,3-benzothiazole;methane;1,3-oxazole (PubChem CID 159931242) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 1,3-benzothiazole;methane;1,3-oxazole.
| Compound Name | 1,3-benzothiazole;methane;1,3-oxazole |
|---|---|
| PubChem CID | 159931242 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1,3-benzothiazole;methane;1,3-oxazole |
| SMILES | C.c1ccc2scnc2c1.c1cocn1 |
| InChI | InChI=1S/C7H5NS.C3H3NO.CH4/c1-2-4-7-6(3-1)8-5-9-7;1-2-5-3-4-1;/h1-5H;1-3H;1H4 |
| InChIKey | NZQXAQQOGJNNEY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |