C15H18F2O4 — CID 159935988
(2R)-5-[4-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxopentanoic acid (PubChem CID 159935988) has the molecular formula C15H18F2O4 and a molecular weight of 300.30 g/mol. Its IUPAC name is (2R)-5-[4-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxopentanoic acid.
| Compound Name | (2R)-5-[4-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxopentanoic acid |
|---|---|
| PubChem CID | 159935988 |
| Molecular Formula | C15H18F2O4 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (2R)-5-[4-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxopentanoic acid |
| SMILES | CC[C@](C)(CC(=O)Cc1ccc(OC(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C15H18F2O4/c1-3-15(2,13(19)20)9-11(18)8-10-4-6-12(7-5-10)21-14(16)17/h4-7,14H,3,8-9H2,1-2H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | OAGGPXXEHBCZCG-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |