C23H21F2NO2 — CID 56522955
2-[4-(difluoromethoxy)phenyl]-N-(1,1-diphenylethyl)acetamide (PubChem CID 56522955) has the molecular formula C23H21F2NO2 and a molecular weight of 381.42 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-N-(1,1-diphenylethyl)acetamide.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-N-(1,1-diphenylethyl)acetamide |
|---|---|
| PubChem CID | 56522955 |
| Molecular Formula | C23H21F2NO2 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-N-(1,1-diphenylethyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccc(OC(F)F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21F2NO2/c1-23(18-8-4-2-5-9-18,19-10-6-3-7-11-19)26-21(27)16-17-12-14-20(15-13-17)28-22(24)25/h2-15,22H,16H2,1H3,(H,26,27) |
| InChIKey | IXWCNTGMQDBOLU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |