C24H26ClNO4 — CID 159936624
2-(4-chlorophenoxy)-N-[3-[4-(4-methylphenoxy)butanoyl]-1-bicyclo[1.1.1]pentanyl]acetamide (PubChem CID 159936624) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-[4-(4-methylphenoxy)butanoyl]-1-bicyclo[1.1.1]pentanyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-[4-(4-methylphenoxy)butanoyl]-1-bicyclo[1.1.1]pentanyl]acetamide |
|---|---|
| PubChem CID | 159936624 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-[4-(4-methylphenoxy)butanoyl]-1-bicyclo[1.1.1]pentanyl]acetamide |
| SMILES | Cc1ccc(OCCCC(=O)C23CC(NC(=O)COc4ccc(Cl)cc4)(C2)C3)cc1 |
| InChI | InChI=1S/C24H26ClNO4/c1-17-4-8-19(9-5-17)29-12-2-3-21(27)23-14-24(15-23,16-23)26-22(28)13-30-20-10-6-18(25)7-11-20/h4-11H,2-3,12-16H2,1H3,(H,26,28) |
| InChIKey | OAIHVVMXGRBUAZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|