C22H24Cl2N2O3 — CID 155303217
2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]acetamide (PubChem CID 155303217) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]acetamide |
|---|---|
| PubChem CID | 155303217 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-[2-(4-chlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC12CC(C1)C(NCCOc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C22H24Cl2N2O3/c23-16-1-5-18(6-2-16)28-10-9-25-20-13-22(11-15(20)12-22)26-21(27)14-29-19-7-3-17(24)4-8-19/h1-8,15,20,25H,9-14H2,(H,26,27) |
| InChIKey | UGKCWTNUXPKBIB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|