C21H29Cl2N3O2 — CID 138626812
N-[3-[2-(3,4-dichlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]-4-methylpiperidine-3-carboxamide (PubChem CID 138626812) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[3-[2-(3,4-dichlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]-4-methylpiperidine-3-carboxamide.
| Compound Name | N-[3-[2-(3,4-dichlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]-4-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 138626812 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[3-[2-(3,4-dichlorophenoxy)ethylamino]-1-bicyclo[2.1.1]hexanyl]-4-methylpiperidine-3-carboxamide |
| SMILES | CC1CCNCC1C(=O)NC12CC(C1)C(NCCOc1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C21H29Cl2N3O2/c1-13-4-5-24-12-16(13)20(27)26-21-9-14(10-21)19(11-21)25-6-7-28-15-2-3-17(22)18(23)8-15/h2-3,8,13-14,16,19,24-25H,4-7,9-12H2,1H3,(H,26,27) |
| InChIKey | YOOFYCWLQLZTQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|