C25H52 — CID 159937980
(3R,4R,5R,6R,7R,10S,11S)-2,3,4,5,6,7,8,8,9,9,10,11-dodecamethyltridecane (PubChem CID 159937980) has the molecular formula C25H52 and a molecular weight of 352.69 g/mol. Its IUPAC name is (3R,4R,5R,6R,7R,10S,11S)-2,3,4,5,6,7,8,8,9,9,10,11-dodecamethyltridecane.
| Compound Name | (3R,4R,5R,6R,7R,10S,11S)-2,3,4,5,6,7,8,8,9,9,10,11-dodecamethyltridecane |
|---|---|
| PubChem CID | 159937980 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | (3R,4R,5R,6R,7R,10S,11S)-2,3,4,5,6,7,8,8,9,9,10,11-dodecamethyltridecane |
| SMILES | CC[C@H](C)[C@H](C)C(C)(C)C(C)(C)[C@H](C)[C@H](C)[C@H](C)[C@H](C)[C@H](C)C(C)C |
| InChI | InChI=1S/C25H52/c1-15-17(4)22(9)24(11,12)25(13,14)23(10)21(8)20(7)19(6)18(5)16(2)3/h16-23H,15H2,1-14H3/t17-,18+,19+,20+,21+,22-,23+/m0/s1 |
| InChIKey | XFJWWVCFSHKLOA-LMRPSFLQSA-N |
| XLogP | 8.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |