C17H12Cl3N3O3 — CID 159941579
2-[2-(2-amino-3H-benzimidazol-5-yl)acetyl]-3,4,5-trichloro-6-methylbenzoic acid (PubChem CID 159941579) has the molecular formula C17H12Cl3N3O3 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2-[2-(2-amino-3H-benzimidazol-5-yl)acetyl]-3,4,5-trichloro-6-methylbenzoic acid.
| Compound Name | 2-[2-(2-amino-3H-benzimidazol-5-yl)acetyl]-3,4,5-trichloro-6-methylbenzoic acid |
|---|---|
| PubChem CID | 159941579 |
| Molecular Formula | C17H12Cl3N3O3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-[2-(2-amino-3H-benzimidazol-5-yl)acetyl]-3,4,5-trichloro-6-methylbenzoic acid |
| SMILES | Cc1c(Cl)c(Cl)c(Cl)c(C(=O)Cc2ccc3nc(N)[nH]c3c2)c1C(=O)O |
| InChI | InChI=1S/C17H12Cl3N3O3/c1-6-11(16(25)26)12(14(19)15(20)13(6)18)10(24)5-7-2-3-8-9(4-7)23-17(21)22-8/h2-4H,5H2,1H3,(H,25,26)(H3,21,22,23) |
| InChIKey | OAYIHSMAWDOLNV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|