C15H8Cl4N4O2 — CID 88589608
N-(2-amino-3H-benzimidazol-5-yl)-2,3,4,5-tetrachloro-6-formylbenzamide (PubChem CID 88589608) has the molecular formula C15H8Cl4N4O2 and a molecular weight of 418.07 g/mol. Its IUPAC name is N-(2-amino-3H-benzimidazol-5-yl)-2,3,4,5-tetrachloro-6-formylbenzamide.
| Compound Name | N-(2-amino-3H-benzimidazol-5-yl)-2,3,4,5-tetrachloro-6-formylbenzamide |
|---|---|
| PubChem CID | 88589608 |
| Molecular Formula | C15H8Cl4N4O2 |
| Molecular Weight | 418.07 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | N-(2-amino-3H-benzimidazol-5-yl)-2,3,4,5-tetrachloro-6-formylbenzamide |
| SMILES | Nc1nc2ccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C=O)cc2[nH]1 |
| InChI | InChI=1S/C15H8Cl4N4O2/c16-10-6(4-24)9(11(17)13(19)12(10)18)14(25)21-5-1-2-7-8(3-5)23-15(20)22-7/h1-4H,(H,21,25)(H3,20,22,23) |
| InChIKey | SWRCTLAPRHHHKX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|