C16H14ClN3O3 — CID 84579347
N-(2-chloro-3H-benzimidazol-5-yl)-2,6-dimethoxybenzamide (PubChem CID 84579347) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is N-(2-chloro-3H-benzimidazol-5-yl)-2,6-dimethoxybenzamide.
| Compound Name | N-(2-chloro-3H-benzimidazol-5-yl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 84579347 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(2-chloro-3H-benzimidazol-5-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc2nc(Cl)[nH]c2c1 |
| InChI | InChI=1S/C16H14ClN3O3/c1-22-12-4-3-5-13(23-2)14(12)15(21)18-9-6-7-10-11(8-9)20-16(17)19-10/h3-8H,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | QJAIWYXWGOVILW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |