C17H16ClN3O4 — CID 84580880
N-(2-chloro-3H-benzimidazol-5-yl)-3,4,5-trimethoxybenzamide (PubChem CID 84580880) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is N-(2-chloro-3H-benzimidazol-5-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2-chloro-3H-benzimidazol-5-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 84580880 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(2-chloro-3H-benzimidazol-5-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc3nc(Cl)[nH]c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16ClN3O4/c1-23-13-6-9(7-14(24-2)15(13)25-3)16(22)19-10-4-5-11-12(8-10)21-17(18)20-11/h4-8H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | TZONEPXGEYBZBX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |