C22H39N3O9 — CID 159945717
2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-5-[[(5S)-5-ethyl-7-hydroxy-6-oxoheptyl]amino]-5-oxopentanoic acid (PubChem CID 159945717) has the molecular formula C22H39N3O9 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-5-[[(5S)-5-ethyl-7-hydroxy-6-oxoheptyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-5-[[(5S)-5-ethyl-7-hydroxy-6-oxoheptyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 159945717 |
| Molecular Formula | C22H39N3O9 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-5-[[(5S)-5-ethyl-7-hydroxy-6-oxoheptyl]amino]-5-oxopentanoic acid |
| SMILES | CCC(CCCCNC(=O)CCC(NC(=O)COCCOCCNC(C)=O)C(=O)O)C(=O)CO |
| InChI | InChI=1S/C22H39N3O9/c1-3-17(19(28)14-26)6-4-5-9-24-20(29)8-7-18(22(31)32)25-21(30)15-34-13-12-33-11-10-23-16(2)27/h17-18,26H,3-15H2,1-2H3,(H,23,27)(H,24,29)(H,25,30)(H,31,32) |
| InChIKey | BBKMWZUSPBOSRC-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|