About 4-phenylmethoxyphenol;pyridin-2-ylmethanol
4-phenylmethoxyphenol;pyridin-2-ylmethanol (PubChem CID 159945891) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-phenylmethoxyphenol;pyridin-2-ylmethanol.
Molecular Properties
| Compound Name | 4-phenylmethoxyphenol;pyridin-2-ylmethanol |
| PubChem CID | 159945891 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-phenylmethoxyphenol;pyridin-2-ylmethanol |
| SMILES | OCc1ccccn1.Oc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O2.C6H7NO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;8-5-6-3-1-2-4-7-6/h1-9,14H,10H2;1-4,8H,5H2 |
| InChIKey | OBMCLPLUGROFFT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenylmethoxyphenol;pyridin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxyphenol;pyridin-2-ylmethanol?
The IUPAC name of 4-phenylmethoxyphenol;pyridin-2-ylmethanol (CID 159945891) is 4-phenylmethoxyphenol;pyridin-2-ylmethanol.
What is the SMILES notation for 4-phenylmethoxyphenol;pyridin-2-ylmethanol?
The canonical SMILES for 4-phenylmethoxyphenol;pyridin-2-ylmethanol is OCc1ccccn1.Oc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of 4-phenylmethoxyphenol;pyridin-2-ylmethanol?
The InChIKey is OBMCLPLUGROFFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2.C6H7NO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;8-5-6-3-1-2-4-7-6/h1-9,14H,10H2;1-4,8H,5H2.
What are the key properties of 4-phenylmethoxyphenol;pyridin-2-ylmethanol?
4-phenylmethoxyphenol;pyridin-2-ylmethanol has a molecular weight of 309.37 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxyphenol;pyridin-2-ylmethanol is sourced from PubChem (CID 159945891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).