C17H18N6O3 — CID 159946728
dimethyl pyridine-2,6-dicarboximidate;6-isocyanopyridine-2-carbonitrile;methanol (PubChem CID 159946728) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is dimethyl pyridine-2,6-dicarboximidate;6-isocyanopyridine-2-carbonitrile;methanol.
| Compound Name | dimethyl pyridine-2,6-dicarboximidate;6-isocyanopyridine-2-carbonitrile;methanol |
|---|---|
| PubChem CID | 159946728 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | dimethyl pyridine-2,6-dicarboximidate;6-isocyanopyridine-2-carbonitrile;methanol |
| SMILES | CO.[C-]#[N+]c1cccc(C#N)n1.[H]/N=C(\OC)c1cccc(/C(=N/[H])OC)n1 |
| InChI | InChI=1S/C9H11N3O2.C7H3N3.CH4O/c1-13-8(10)6-4-3-5-7(12-6)9(11)14-2;1-9-7-4-2-3-6(5-8)10-7;1-2/h3-5,10-11H,1-2H3;2-4H;2H,1H3/b10-8-,11-9-;; |
| InChIKey | OBOVSIIVWHPCHU-UJJOPKMPSA-N |
| XLogP | 2.14 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|