C24H22Cl2FN7O3 — CID 159948083
1-[4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]-2-propoxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 159948083) has the molecular formula C24H22Cl2FN7O3 and a molecular weight of 546.39 g/mol. Its IUPAC name is 1-[4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]-2-propoxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]-2-propoxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 159948083 |
| Molecular Formula | C24H22Cl2FN7O3 |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 1-[4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]-2-propoxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCCC)nc3c(Oc4c(Cl)c(F)cc5[nH]ncc45)nc(Cl)cc23)CC1 |
| InChI | InChI=1S/C24H22Cl2FN7O3/c1-3-9-36-24-30-20-13(22(31-24)34-7-5-33(6-8-34)18(35)4-2)10-17(25)29-23(20)37-21-14-12-28-32-16(14)11-15(27)19(21)26/h4,10-12H,2-3,5-9H2,1H3,(H,28,32) |
| InChIKey | OGYPNKGWDXVSLI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|