C23H20Cl2FN7O2 — CID 139345903
1-[(2R,5S)-4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 139345903) has the molecular formula C23H20Cl2FN7O2 and a molecular weight of 516.36 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139345903 |
| Molecular Formula | C23H20Cl2FN7O2 |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 1-[(2R,5S)-4-[6-chloro-8-[(5-chloro-6-fluoro-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2ncnc3c(Oc4c(Cl)c(F)cc5[nH]ncc45)nc(Cl)cc23)C[C@H]1C |
| InChI | InChI=1S/C23H20Cl2FN7O2/c1-4-18(34)32-8-12(3)33(9-11(32)2)22-13-5-17(24)30-23(20(13)27-10-28-22)35-21-14-7-29-31-16(14)6-15(26)19(21)25/h4-7,10-12H,1,8-9H2,2-3H3,(H,29,31)/t11-,12+/m1/s1 |
| InChIKey | JDZMSARBQBBIPI-NEPJUHHUSA-N |
| XLogP | 4.75 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|