C21H30N4O6S2 — CID 15995006
N-(3-morpholin-4-ylpropyl)-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 15995006) has the molecular formula C21H30N4O6S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 15995006 |
| Molecular Formula | C21H30N4O6S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccc(S(=O)(=O)N3CCOCC3)cc21)NCCCN1CCOCC1 |
| InChI | InChI=1S/C21H30N4O6S2/c26-20(22-4-1-5-23-6-10-30-11-7-23)15-25-18-14-17(2-3-19(18)32-16-21(25)27)33(28,29)24-8-12-31-13-9-24/h2-3,14H,1,4-13,15-16H2,(H,22,26) |
| InChIKey | XIFQYFTUPLPWTQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|