C16H15Cl2IN8 — CID 159953688
2-chloro-5-iodopyridine;1-(6-chloro-3-pyridinyl)pyrazol-3-amine;1H-pyrazol-5-amine (PubChem CID 159953688) has the molecular formula C16H15Cl2IN8 and a molecular weight of 517.16 g/mol. Its IUPAC name is 2-chloro-5-iodopyridine;1-(6-chloro-3-pyridinyl)pyrazol-3-amine;1H-pyrazol-5-amine.
| Compound Name | 2-chloro-5-iodopyridine;1-(6-chloro-3-pyridinyl)pyrazol-3-amine;1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 159953688 |
| Molecular Formula | C16H15Cl2IN8 |
| Molecular Weight | 517.16 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 2-chloro-5-iodopyridine;1-(6-chloro-3-pyridinyl)pyrazol-3-amine;1H-pyrazol-5-amine |
| SMILES | Clc1ccc(I)cn1.Nc1ccn(-c2ccc(Cl)nc2)n1.Nc1ccn[nH]1 |
| InChI | InChI=1S/C8H7ClN4.C5H3ClIN.C3H5N3/c9-7-2-1-6(5-11-7)13-4-3-8(10)12-13;6-5-2-1-4(7)3-8-5;4-3-1-2-5-6-3/h1-5H,(H2,10,12);1-3H;1-2H,(H3,4,5,6) |
| InChIKey | OCLCFADEKIOBLI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.16 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|