C22H31NO3 — CID 159958714
3-[4-(2-tert-butylphenoxy)piperidine-1-carbonyl]cyclohexan-1-one (PubChem CID 159958714) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 3-[4-(2-tert-butylphenoxy)piperidine-1-carbonyl]cyclohexan-1-one.
| Compound Name | 3-[4-(2-tert-butylphenoxy)piperidine-1-carbonyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 159958714 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 3-[4-(2-tert-butylphenoxy)piperidine-1-carbonyl]cyclohexan-1-one |
| SMILES | CC(C)(C)c1ccccc1OC1CCN(C(=O)C2CCCC(=O)C2)CC1 |
| InChI | InChI=1S/C22H31NO3/c1-22(2,3)19-9-4-5-10-20(19)26-18-11-13-23(14-12-18)21(25)16-7-6-8-17(24)15-16/h4-5,9-10,16,18H,6-8,11-15H2,1-3H3 |
| InChIKey | ODAVCWOQZKSWMZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |