C23H35N3O5 — CID 126490697
tert-butyl N-[[3-[4-(2-tert-butylphenoxy)piperidin-1-yl]-3-oxopropanoyl]amino]carbamate (PubChem CID 126490697) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[[3-[4-(2-tert-butylphenoxy)piperidin-1-yl]-3-oxopropanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[3-[4-(2-tert-butylphenoxy)piperidin-1-yl]-3-oxopropanoyl]amino]carbamate |
|---|---|
| PubChem CID | 126490697 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl N-[[3-[4-(2-tert-butylphenoxy)piperidin-1-yl]-3-oxopropanoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CC(=O)N1CCC(Oc2ccccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H35N3O5/c1-22(2,3)17-9-7-8-10-18(17)30-16-11-13-26(14-12-16)20(28)15-19(27)24-25-21(29)31-23(4,5)6/h7-10,16H,11-15H2,1-6H3,(H,24,27)(H,25,29) |
| InChIKey | KFGYLVPOTBFZMC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|