C23H28FNO4S — CID 59577235
1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfinylethanone (PubChem CID 59577235) has the molecular formula C23H28FNO4S and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfinylethanone.
| Compound Name | 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfinylethanone |
|---|---|
| PubChem CID | 59577235 |
| Molecular Formula | C23H28FNO4S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfinylethanone |
| SMILES | CC(C)(C)c1cc(F)ccc1OC1CCN(C(=O)CS(=O)c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H28FNO4S/c1-23(2,3)18-14-16(24)8-9-20(18)29-17-10-12-25(13-11-17)22(27)15-30(28)21-7-5-4-6-19(21)26/h4-9,14,17,26H,10-13,15H2,1-3H3 |
| InChIKey | ZQLPQGUHSVNLLW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |