C21H30FNO4 — CID 59577152
methyl 4-[4-[(2-tert-butyl-4-fluorophenoxy)methyl]piperidin-1-yl]-4-oxobutanoate (PubChem CID 59577152) has the molecular formula C21H30FNO4 and a molecular weight of 379.47 g/mol. Its IUPAC name is methyl 4-[4-[(2-tert-butyl-4-fluorophenoxy)methyl]piperidin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[(2-tert-butyl-4-fluorophenoxy)methyl]piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 59577152 |
| Molecular Formula | C21H30FNO4 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | methyl 4-[4-[(2-tert-butyl-4-fluorophenoxy)methyl]piperidin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCC(COc2ccc(F)cc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H30FNO4/c1-21(2,3)17-13-16(22)5-6-18(17)27-14-15-9-11-23(12-10-15)19(24)7-8-20(25)26-4/h5-6,13,15H,7-12,14H2,1-4H3 |
| InChIKey | UXDUGWDENQSUMQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |