C18H26FNO4 — CID 126490335
1-[3-[(2-tert-butyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2-hydroxy-2-methoxyethanone (PubChem CID 126490335) has the molecular formula C18H26FNO4 and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-[3-[(2-tert-butyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2-hydroxy-2-methoxyethanone.
| Compound Name | 1-[3-[(2-tert-butyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2-hydroxy-2-methoxyethanone |
|---|---|
| PubChem CID | 126490335 |
| Molecular Formula | C18H26FNO4 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[3-[(2-tert-butyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2-hydroxy-2-methoxyethanone |
| SMILES | COC(O)C(=O)N1CCC(COc2ccc(F)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C18H26FNO4/c1-18(2,3)14-9-13(19)5-6-15(14)24-11-12-7-8-20(10-12)16(21)17(22)23-4/h5-6,9,12,17,22H,7-8,10-11H2,1-4H3 |
| InChIKey | UEKZPSAJAPSOBX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|