C21H28FNO4 — CID 130297218
3-[3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 130297218) has the molecular formula C21H28FNO4 and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-[3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 130297218 |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-[3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)N1CCC(COc2ccc(F)cc2C2CCCC2)C1 |
| InChI | InChI=1S/C21H28FNO4/c1-21(2,20(25)26)19(24)23-10-9-14(12-23)13-27-18-8-7-16(22)11-17(18)15-5-3-4-6-15/h7-8,11,14-15H,3-6,9-10,12-13H2,1-2H3,(H,25,26) |
| InChIKey | PKAIVJCFXYKFAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|