C19H30FNO2 — CID 126490330
3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-[(2-methylpropan-2-yl)oxy]pyrrolidine (PubChem CID 126490330) has the molecular formula C19H30FNO2 and a molecular weight of 323.45 g/mol. Its IUPAC name is 3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-[(2-methylpropan-2-yl)oxy]pyrrolidine.
| Compound Name | 3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-[(2-methylpropan-2-yl)oxy]pyrrolidine |
|---|---|
| PubChem CID | 126490330 |
| Molecular Formula | C19H30FNO2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-[(2-methylpropan-2-yl)oxy]pyrrolidine |
| SMILES | CC(C)(C)ON1CCC(COc2ccc(F)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C19H30FNO2/c1-18(2,3)16-11-15(20)7-8-17(16)22-13-14-9-10-21(12-14)23-19(4,5)6/h7-8,11,14H,9-10,12-13H2,1-6H3 |
| InChIKey | UZDMOPWKOQTSJT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |