C20H29NO6 — CID 91384573
[1-[3-[(2-tert-butylphenoxy)methyl]pyrrolidin-1-yl]peroxy-1-oxopropan-2-yl] acetate (PubChem CID 91384573) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is [1-[3-[(2-tert-butylphenoxy)methyl]pyrrolidin-1-yl]peroxy-1-oxopropan-2-yl] acetate.
| Compound Name | [1-[3-[(2-tert-butylphenoxy)methyl]pyrrolidin-1-yl]peroxy-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 91384573 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [1-[3-[(2-tert-butylphenoxy)methyl]pyrrolidin-1-yl]peroxy-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(=O)OON1CCC(COc2ccccc2C(C)(C)C)C1 |
| InChI | InChI=1S/C20H29NO6/c1-14(25-15(2)22)19(23)26-27-21-11-10-16(12-21)13-24-18-9-7-6-8-17(18)20(3,4)5/h6-9,14,16H,10-13H2,1-5H3 |
| InChIKey | XGTKNTNCSBWTQT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|