C23H34FNO — CID 126490745
3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine (PubChem CID 126490745) has the molecular formula C23H34FNO and a molecular weight of 359.53 g/mol. Its IUPAC name is 3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine.
| Compound Name | 3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 126490745 |
| Molecular Formula | C23H34FNO |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 3-[(2-tert-butyl-4-fluorophenoxy)methyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine |
| SMILES | C=C(CCC)CC(=C)N1CCC(COc2ccc(F)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C23H34FNO/c1-7-8-17(2)13-18(3)25-12-11-19(15-25)16-26-22-10-9-20(24)14-21(22)23(4,5)6/h9-10,14,19H,2-3,7-8,11-13,15-16H2,1,4-6H3 |
| InChIKey | NCTZQRFSMFBXQG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|