C21H30FNO — CID 126490336
3-[2-(2-tert-butyl-4-fluorophenyl)ethyl]-1-(3-methoxybuta-1,3-dien-2-yl)pyrrolidine (PubChem CID 126490336) has the molecular formula C21H30FNO and a molecular weight of 331.48 g/mol. Its IUPAC name is 3-[2-(2-tert-butyl-4-fluorophenyl)ethyl]-1-(3-methoxybuta-1,3-dien-2-yl)pyrrolidine.
| Compound Name | 3-[2-(2-tert-butyl-4-fluorophenyl)ethyl]-1-(3-methoxybuta-1,3-dien-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 126490336 |
| Molecular Formula | C21H30FNO |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-[2-(2-tert-butyl-4-fluorophenyl)ethyl]-1-(3-methoxybuta-1,3-dien-2-yl)pyrrolidine |
| SMILES | C=C(OC)C(=C)N1CCC(CCc2ccc(F)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C21H30FNO/c1-15(16(2)24-6)23-12-11-17(14-23)7-8-18-9-10-19(22)13-20(18)21(3,4)5/h9-10,13,17H,1-2,7-8,11-12,14H2,3-6H3 |
| InChIKey | IZEPLORPQYMWCQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|