C24H36ClN — CID 126490539
3-[2-(2-tert-butyl-4-chlorophenyl)ethyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine (PubChem CID 126490539) has the molecular formula C24H36ClN and a molecular weight of 374.01 g/mol. Its IUPAC name is 3-[2-(2-tert-butyl-4-chlorophenyl)ethyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine.
| Compound Name | 3-[2-(2-tert-butyl-4-chlorophenyl)ethyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 126490539 |
| Molecular Formula | C24H36ClN |
| Molecular Weight | 374.01 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 3-[2-(2-tert-butyl-4-chlorophenyl)ethyl]-1-(4-methylidenehept-1-en-2-yl)pyrrolidine |
| SMILES | C=C(CCC)CC(=C)N1CCC(CCc2ccc(Cl)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C24H36ClN/c1-7-8-18(2)15-19(3)26-14-13-20(17-26)9-10-21-11-12-22(25)16-23(21)24(4,5)6/h11-12,16,20H,2-3,7-10,13-15,17H2,1,4-6H3 |
| InChIKey | JCHLHYVLCLQXKS-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.01 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|