C24H34FNO — CID 126490523
1-[1-[1-[4-[2-(2-tert-butyl-4-fluorophenyl)ethyl]piperidin-1-yl]ethenyl]cyclopropyl]ethenol (PubChem CID 126490523) has the molecular formula C24H34FNO and a molecular weight of 371.54 g/mol. Its IUPAC name is 1-[1-[1-[4-[2-(2-tert-butyl-4-fluorophenyl)ethyl]piperidin-1-yl]ethenyl]cyclopropyl]ethenol.
| Compound Name | 1-[1-[1-[4-[2-(2-tert-butyl-4-fluorophenyl)ethyl]piperidin-1-yl]ethenyl]cyclopropyl]ethenol |
|---|---|
| PubChem CID | 126490523 |
| Molecular Formula | C24H34FNO |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-[1-[1-[4-[2-(2-tert-butyl-4-fluorophenyl)ethyl]piperidin-1-yl]ethenyl]cyclopropyl]ethenol |
| SMILES | C=C(O)C1(C(=C)N2CCC(CCc3ccc(F)cc3C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C24H34FNO/c1-17(24(12-13-24)18(2)27)26-14-10-19(11-15-26)6-7-20-8-9-21(25)16-22(20)23(3,4)5/h8-9,16,19,27H,1-2,6-7,10-15H2,3-5H3 |
| InChIKey | YYBJHJQZXAEWEF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|