C20H29FN4 — CID 126490430
2-[4-[(2-tert-butyl-4-fluorophenyl)methyl]piperidin-1-yl]-N'-methanimidoylprop-2-enimidamide (PubChem CID 126490430) has the molecular formula C20H29FN4 and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[4-[(2-tert-butyl-4-fluorophenyl)methyl]piperidin-1-yl]-N'-methanimidoylprop-2-enimidamide.
| Compound Name | 2-[4-[(2-tert-butyl-4-fluorophenyl)methyl]piperidin-1-yl]-N'-methanimidoylprop-2-enimidamide |
|---|---|
| PubChem CID | 126490430 |
| Molecular Formula | C20H29FN4 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-[4-[(2-tert-butyl-4-fluorophenyl)methyl]piperidin-1-yl]-N'-methanimidoylprop-2-enimidamide |
| SMILES | [H]/N=C/N=C(\N)C(=C)N1CCC(Cc2ccc(F)cc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H29FN4/c1-14(19(23)24-13-22)25-9-7-15(8-10-25)11-16-5-6-17(21)12-18(16)20(2,3)4/h5-6,12-13,15H,1,7-11H2,2-4H3,(H3,22,23,24) |
| InChIKey | MTXDQDSWXALDAJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|