C24H37N3O3 — CID 126490699
tert-butyl N-[2-[4-[(2-tert-butylphenyl)methyl]piperidin-1-yl]prop-2-enoylamino]carbamate (PubChem CID 126490699) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2-tert-butylphenyl)methyl]piperidin-1-yl]prop-2-enoylamino]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(2-tert-butylphenyl)methyl]piperidin-1-yl]prop-2-enoylamino]carbamate |
|---|---|
| PubChem CID | 126490699 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | tert-butyl N-[2-[4-[(2-tert-butylphenyl)methyl]piperidin-1-yl]prop-2-enoylamino]carbamate |
| SMILES | C=C(C(=O)NNC(=O)OC(C)(C)C)N1CCC(Cc2ccccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H37N3O3/c1-17(21(28)25-26-22(29)30-24(5,6)7)27-14-12-18(13-15-27)16-19-10-8-9-11-20(19)23(2,3)4/h8-11,18H,1,12-16H2,2-7H3,(H,25,28)(H,26,29) |
| InChIKey | AXCBFAQOJVWEBH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|