C21H28FNO2 — CID 130372590
[3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-(1-methylcyclopropyl)methanone (PubChem CID 130372590) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is [3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-(1-methylcyclopropyl)methanone.
| Compound Name | [3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-(1-methylcyclopropyl)methanone |
|---|---|
| PubChem CID | 130372590 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [3-[(2-cyclopentyl-4-fluorophenoxy)methyl]pyrrolidin-1-yl]-(1-methylcyclopropyl)methanone |
| SMILES | CC1(C(=O)N2CCC(COc3ccc(F)cc3C3CCCC3)C2)CC1 |
| InChI | InChI=1S/C21H28FNO2/c1-21(9-10-21)20(24)23-11-8-15(13-23)14-25-19-7-6-17(22)12-18(19)16-4-2-3-5-16/h6-7,12,15-16H,2-5,8-11,13-14H2,1H3 |
| InChIKey | QYQNVVXTJFBBCU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |