C23H28FNO5S — CID 59577027
1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfonylethanone (PubChem CID 59577027) has the molecular formula C23H28FNO5S and a molecular weight of 449.54 g/mol. Its IUPAC name is 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfonylethanone.
| Compound Name | 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfonylethanone |
|---|---|
| PubChem CID | 59577027 |
| Molecular Formula | C23H28FNO5S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(2-hydroxyphenyl)sulfonylethanone |
| SMILES | CC(C)(C)c1cc(F)ccc1OC1CCN(C(=O)CS(=O)(=O)c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H28FNO5S/c1-23(2,3)18-14-16(24)8-9-20(18)30-17-10-12-25(13-11-17)22(27)15-31(28,29)21-7-5-4-6-19(21)26/h4-9,14,17,26H,10-13,15H2,1-3H3 |
| InChIKey | SIIXMEAIPPMEGB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |