C23H31FN4O3 — CID 143793284
1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(N,2-diaminoanilino)oxyethanone (PubChem CID 143793284) has the molecular formula C23H31FN4O3 and a molecular weight of 430.52 g/mol. Its IUPAC name is 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(N,2-diaminoanilino)oxyethanone.
| Compound Name | 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(N,2-diaminoanilino)oxyethanone |
|---|---|
| PubChem CID | 143793284 |
| Molecular Formula | C23H31FN4O3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-[4-(2-tert-butyl-4-fluorophenoxy)piperidin-1-yl]-2-(N,2-diaminoanilino)oxyethanone |
| SMILES | CC(C)(C)c1cc(F)ccc1OC1CCN(C(=O)CON(N)c2ccccc2N)CC1 |
| InChI | InChI=1S/C23H31FN4O3/c1-23(2,3)18-14-16(24)8-9-21(18)31-17-10-12-27(13-11-17)22(29)15-30-28(26)20-7-5-4-6-19(20)25/h4-9,14,17H,10-13,15,25-26H2,1-3H3 |
| InChIKey | ZJCMHGMOGVEIBO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|