acetic acid;decanoic acid;propane-1,2,3-triol

C19H40O11 — CID 159959131

IUPACacetic acid;decanoic acid;propane-1,2,3-triol
SMILESCC(=O)O.CC(=O)O.CC(=O)O.CCCCCCCCCC(=O)O.OCC(O)CO
InChIInChI=1S/C10H20O2.C3H8O3.3C2H4O2/c1-2-3-4-5-6-7-8-9-10(11)12;4-1-3(6)2-5;3*1-2(3)4/h2-9H2,1H3,(H,11,12);3-6H,1-2H2;3*1H3,(H,3,4)
InChIKeyZBUSBVKHWZGLQR-UHFFFAOYSA-N
MW444.52 g/mol
LogP1.82
Rot. Bonds10

About acetic acid;decanoic acid;propane-1,2,3-triol

acetic acid;decanoic acid;propane-1,2,3-triol (PubChem CID 159959131) has the molecular formula C19H40O11 and a molecular weight of 444.52 g/mol. Its IUPAC name is acetic acid;decanoic acid;propane-1,2,3-triol.

Molecular Properties

Compound Nameacetic acid;decanoic acid;propane-1,2,3-triol
PubChem CID159959131
Molecular FormulaC19H40O11
Molecular Weight444.52 g/mol
Exact Mass444.26
IUPAC Nameacetic acid;decanoic acid;propane-1,2,3-triol
SMILESCC(=O)O.CC(=O)O.CC(=O)O.CCCCCCCCCC(=O)O.OCC(O)CO
InChIInChI=1S/C10H20O2.C3H8O3.3C2H4O2/c1-2-3-4-5-6-7-8-9-10(11)12;4-1-3(6)2-5;3*1-2(3)4/h2-9H2,1H3,(H,11,12);3-6H,1-2H2;3*1H3,(H,3,4)
InChIKeyZBUSBVKHWZGLQR-UHFFFAOYSA-N
XLogP1.82
TPSA209.89 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds10
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500444.52
LogP ≤ 51.82
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze acetic acid;decanoic acid;propane-1,2,3-triol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;decanoic acid;propane-1,2,3-triol?
The IUPAC name of acetic acid;decanoic acid;propane-1,2,3-triol (CID 159959131) is acetic acid;decanoic acid;propane-1,2,3-triol.
What is the SMILES notation for acetic acid;decanoic acid;propane-1,2,3-triol?
The canonical SMILES for acetic acid;decanoic acid;propane-1,2,3-triol is CC(=O)O.CC(=O)O.CC(=O)O.CCCCCCCCCC(=O)O.OCC(O)CO.
What is the InChIKey of acetic acid;decanoic acid;propane-1,2,3-triol?
The InChIKey is ZBUSBVKHWZGLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C3H8O3.3C2H4O2/c1-2-3-4-5-6-7-8-9-10(11)12;4-1-3(6)2-5;3*1-2(3)4/h2-9H2,1H3,(H,11,12);3-6H,1-2H2;3*1H3,(H,3,4).
What are the key properties of acetic acid;decanoic acid;propane-1,2,3-triol?
acetic acid;decanoic acid;propane-1,2,3-triol has a molecular weight of 444.52 g/mol, XLogP of 1.82, 10 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;decanoic acid;propane-1,2,3-triol is sourced from PubChem (CID 159959131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).