C12H11ClN4O3S — CID 15996179
N-(3-chlorophenyl)-2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfanyl]acetamide (PubChem CID 15996179) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 15996179 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1[nH]nc(SCC(=O)Nc2cccc(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11ClN4O3S/c1-7-11(17(19)20)12(16-15-7)21-6-10(18)14-9-4-2-3-8(13)5-9/h2-5H,6H2,1H3,(H,14,18)(H,15,16) |
| InChIKey | PIONMDVBHPBDKC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|