C36H29Cl3N10 — CID 159965413
2-chloro-5-phenyl-N-(pyridin-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine;2,4-dichloro-5-phenylpyrrolo[2,1-f][1,2,4]triazine;pyridin-2-ylmethanamine (PubChem CID 159965413) has the molecular formula C36H29Cl3N10 and a molecular weight of 708.06 g/mol. Its IUPAC name is 2-chloro-5-phenyl-N-(pyridin-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine;2,4-dichloro-5-phenylpyrrolo[2,1-f][1,2,4]triazine;pyridin-2-ylmethanamine.
| Compound Name | 2-chloro-5-phenyl-N-(pyridin-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine;2,4-dichloro-5-phenylpyrrolo[2,1-f][1,2,4]triazine;pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 159965413 |
| Molecular Formula | C36H29Cl3N10 |
| Molecular Weight | 708.06 g/mol |
| Exact Mass | 706.16 |
| IUPAC Name | 2-chloro-5-phenyl-N-(pyridin-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine;2,4-dichloro-5-phenylpyrrolo[2,1-f][1,2,4]triazine;pyridin-2-ylmethanamine |
| SMILES | Clc1nc(Cl)c2c(-c3ccccc3)ccn2n1.Clc1nc(NCc2ccccn2)c2c(-c3ccccc3)ccn2n1.NCc1ccccn1 |
| InChI | InChI=1S/C18H14ClN5.C12H7Cl2N3.C6H8N2/c19-18-22-17(21-12-14-8-4-5-10-20-14)16-15(9-11-24(16)23-18)13-6-2-1-3-7-13;13-11-10-9(8-4-2-1-3-5-8)6-7-17(10)16-12(14)15-11;7-5-6-3-1-2-4-8-6/h1-11H,12H2,(H,21,22,23);1-7H;1-4H,5,7H2 |
| InChIKey | ODWFTRNXHIRHOH-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.06 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |