About 6-azidohexan-1-ol;6-bromohexan-1-ol
6-azidohexan-1-ol;6-bromohexan-1-ol (PubChem CID 159972484) has the molecular formula C12H26BrN3O2
and a molecular weight of 324.26 g/mol. Its IUPAC name is 6-azidohexan-1-ol;6-bromohexan-1-ol.
Molecular Properties
| Compound Name | 6-azidohexan-1-ol;6-bromohexan-1-ol |
| PubChem CID | 159972484 |
| Molecular Formula | C12H26BrN3O2 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 6-azidohexan-1-ol;6-bromohexan-1-ol |
| SMILES | OCCCCCCBr.[N-]=[N+]=NCCCCCCO |
| InChI | InChI=1S/C6H13BrO.C6H13N3O/c7-5-3-1-2-4-6-8;7-9-8-5-3-1-2-4-6-10/h8H,1-6H2;10H,1-6H2 |
| InChIKey | OESNUWMYLLTZAN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-azidohexan-1-ol;6-bromohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azidohexan-1-ol;6-bromohexan-1-ol?
The IUPAC name of 6-azidohexan-1-ol;6-bromohexan-1-ol (CID 159972484) is 6-azidohexan-1-ol;6-bromohexan-1-ol.
What is the SMILES notation for 6-azidohexan-1-ol;6-bromohexan-1-ol?
The canonical SMILES for 6-azidohexan-1-ol;6-bromohexan-1-ol is OCCCCCCBr.[N-]=[N+]=NCCCCCCO.
What is the InChIKey of 6-azidohexan-1-ol;6-bromohexan-1-ol?
The InChIKey is OESNUWMYLLTZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13BrO.C6H13N3O/c7-5-3-1-2-4-6-8;7-9-8-5-3-1-2-4-6-10/h8H,1-6H2;10H,1-6H2.
What are the key properties of 6-azidohexan-1-ol;6-bromohexan-1-ol?
6-azidohexan-1-ol;6-bromohexan-1-ol has a molecular weight of 324.26 g/mol, XLogP of 3.78, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azidohexan-1-ol;6-bromohexan-1-ol is sourced from PubChem (CID 159972484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).