About 1-azido-10-bromodecane;triphenylphosphane
1-azido-10-bromodecane;triphenylphosphane (PubChem CID 134561974) has the molecular formula C28H35BrN3P
and a molecular weight of 524.49 g/mol. Its IUPAC name is 1-azido-10-bromodecane;triphenylphosphane.
Molecular Properties
| Compound Name | 1-azido-10-bromodecane;triphenylphosphane |
| PubChem CID | 134561974 |
| Molecular Formula | C28H35BrN3P |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 1-azido-10-bromodecane;triphenylphosphane |
| SMILES | [N-]=[N+]=NCCCCCCCCCCBr.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C10H20BrN3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;11-9-7-5-3-1-2-4-6-8-10-13-14-12/h1-15H;1-10H2 |
| InChIKey | HHRWGVMITTUETP-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-10-bromodecane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-10-bromodecane;triphenylphosphane?
The IUPAC name of 1-azido-10-bromodecane;triphenylphosphane (CID 134561974) is 1-azido-10-bromodecane;triphenylphosphane.
What is the SMILES notation for 1-azido-10-bromodecane;triphenylphosphane?
The canonical SMILES for 1-azido-10-bromodecane;triphenylphosphane is [N-]=[N+]=NCCCCCCCCCCBr.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-azido-10-bromodecane;triphenylphosphane?
The InChIKey is HHRWGVMITTUETP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C10H20BrN3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;11-9-7-5-3-1-2-4-6-8-10-13-14-12/h1-15H;1-10H2.
What are the key properties of 1-azido-10-bromodecane;triphenylphosphane?
1-azido-10-bromodecane;triphenylphosphane has a molecular weight of 524.49 g/mol, XLogP of 8.26, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-10-bromodecane;triphenylphosphane is sourced from PubChem (CID 134561974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).